CAS 1000339-76-3: Ethyl 2-(1-piperidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate
Description:Ethyl 2-(1-piperidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The piperidine moiety contributes to the compound's potential pharmacological properties, as piperidine derivatives are often associated with various biological activities. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis often involves multi-step reactions, including the formation of the thiazole ring and subsequent functionalization. Ethyl 2-(1-piperidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate may be explored for applications in drug development, particularly in the context of targeting specific biological pathways or receptors. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H15F3N2O2S
InChI:InChI=1S/C12H15F3N2O2S/c1-2-19-10(18)8-9(12(13,14)15)16-11(20-8)17-6-4-3-5-7-17/h2-7H2,1H3
InChI key:InChIKey=XWDSUHQVOIRDMH-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1SC(=NC1C(F)(F)F)N2CCCCC2
- Synonyms:
- Ethyl 2-(1-piperidinyl)-4-(trifluoromethyl)-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 2-(1-piperidinyl)-4-(trifluoromethyl)-, ethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 2-(piperidin-1-yl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate REF: 54-PC7552CAS: 1000339-76-3 | - - - | To inquire | Fri 14 Mar 25 |
![]() | Ethyl 2-(piperidin-1-yl)-4-(trifluoromethyl)-1 REF: 3D-AQB33976CAS: 1000339-76-3 | Min. 95% | - - - | Discontinued product |

Ethyl 2-(piperidin-1-yl)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
Ref: 54-PC7552
Undefined size | To inquire |

Ethyl 2-(piperidin-1-yl)-4-(trifluoromethyl)-1
Ref: 3D-AQB33976
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |