CAS 1000339-90-1
:4-[2-[4-(Trifluoromethyl)-1-piperidinyl]acetyl]-1H-pyrrole-2-carboxaldehyde
Description:
4-[2-[4-(Trifluoromethyl)-1-piperidinyl]acetyl]-1H-pyrrole-2-carboxaldehyde is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring, a piperidine moiety, and a trifluoromethyl group. The presence of the trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its biological activity. The aldehyde functional group contributes to its reactivity, allowing for various chemical transformations. This compound may exhibit significant pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 4-[2-[4-(Trifluoromethyl)-1-piperidinyl]acetyl]-1H-pyrrole-2-carboxaldehyde represents a versatile scaffold for further chemical modifications and applications in various fields, including agrochemicals and materials science.
Formula:C13H15F3N2O2
InChI:InChI=1S/C13H15F3N2O2/c14-13(15,16)10-1-3-18(4-2-10)7-12(20)9-5-11(8-19)17-6-9/h5-6,8,10,17H,1-4,7H2
InChI key:InChIKey=MNSUSUVIFGCERK-UHFFFAOYSA-N
SMILES:C(CN1CCC(C(F)(F)F)CC1)(=O)C=2C=C(C=O)NC2
Synonyms:- 1H-Pyrrole-2-carboxaldehyde, 4-[2-[4-(trifluoromethyl)-1-piperidinyl]acetyl]-
- 4-[2-[4-(Trifluoromethyl)-1-piperidinyl]acetyl]-1H-pyrrole-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-{[4-(Trifluoromethyl)piperidin-1-yl]acetyl}-1H-pyrrole-2-carboxaldehyde
CAS:4-{[4-(Trifluoromethyl)piperidin-1-yl]acetyl}-1H-pyrrole-2-carboxaldehyde
Molecular weight:288.27g/mol
