CymitQuimica logo

CAS 1000340-20-4

:

3-Bromo-6-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine

Description:
3-Bromo-6-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and a pyrrole moiety. The presence of a bromine atom at the 3-position, a methyl group at the 6-position, and a nitro group at the 5-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its nitro group can participate in electrophilic substitution reactions, while the bromine atom can serve as a leaving group in nucleophilic substitution reactions. The presence of multiple functional groups makes it a potential candidate for various applications in medicinal chemistry and material science. Additionally, the compound's structure suggests potential biological activity, which may warrant further investigation in pharmacological studies. Safety data should be consulted before handling, as halogenated compounds can pose health risks.
Formula:C8H6BrN3O2
InChI:InChI=1S/C8H6BrN3O2/c1-4-7(12(13)14)2-5-6(9)3-10-8(5)11-4/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=OAVGDDMDWNKGOE-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=NC(C)=C(N(=O)=O)C2)NC1
Synonyms:
  • 3-Bromo-6-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-6-methyl-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.