
CAS 1000340-23-7
:6-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine
Description:
6-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyridine rings. This compound features a methyl group and a nitro group, which contribute to its chemical reactivity and potential biological activity. The presence of the amino group at the 5-position enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The nitro group can serve as a functional handle for further modifications or as a site for reduction reactions. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many nitrogen-containing heterocycles, it may also display unique electronic properties due to the delocalization of electrons within its aromatic system. Overall, 6-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C8H8N4O2
InChI:InChI=1S/C8H8N4O2/c1-4-6(9)2-5-7(12(13)14)3-10-8(5)11-4/h2-3H,9H2,1H3,(H,10,11)
InChI key:InChIKey=XLVOZMGRKACBNZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(=NC(C)=C(N)C2)NC1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridin-5-amine, 6-methyl-3-nitro-
- 6-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
