
CAS 1000340-32-8
:8-Bromo-1,5-dihydrodipyrrolo[2,3-b:2′,3′-e]pyridine
Description:
8-Bromo-1,5-dihydrodipyrrolo[2,3-b:2′,3′-e]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a bromine atom at the 8-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits a range of chemical properties, including solubility in polar organic solvents, which can facilitate its use in various chemical reactions. Its unique structure may also impart interesting electronic properties, making it a candidate for studies in materials science and drug development. The compound's synthesis often involves multi-step processes, highlighting its significance in advanced organic synthesis. Additionally, due to the presence of nitrogen atoms in its structure, it may exhibit basicity and participate in coordination chemistry. Overall, 8-Bromo-1,5-dihydrodipyrrolo[2,3-b:2′,3′-e]pyridine is a valuable compound in the field of organic chemistry, with potential applications in pharmaceuticals and materials.
Formula:C9H6BrN3
InChI:InChI=1S/C9H6BrN3/c10-7-5-1-3-12-9(5)13-6-2-4-11-8(6)7/h1-4,11H,(H,12,13)
InChI key:InChIKey=UPECHEPHCNRNNX-UHFFFAOYSA-N
SMILES:BrC1=C2C(NC3=C1NC=C3)=NC=C2
Synonyms:- Dipyrrolo[2,3-b:2′,3′-e]pyridine, 8-bromo-1,5-dihydro-
- 8-Bromo-1,5-dihydrodipyrrolo[2,3-b:2′,3′-e]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
