CAS 1000340-34-0: 4-Bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine
Description:4-Bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and iodine substituents at the 4 and 3 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, making it useful in various synthetic applications. Its structure allows for potential interactions in biological systems, which may be explored for pharmaceutical applications. The compound's reactivity can be attributed to the electron-withdrawing nature of the halogen substituents, influencing its electrophilic and nucleophilic behavior. Additionally, the presence of nitrogen atoms in the ring system can participate in hydrogen bonding and coordination with metal ions, further expanding its utility in coordination chemistry and catalysis. Overall, 4-Bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in organic synthesis and medicinal chemistry.
Formula:C7H4BrIN2
InChI:InChI=1S/C7H4BrIN2/c8-4-1-2-10-7-6(4)5(9)3-11-7/h1-3H,(H,10,11)
InChI key:InChIKey=HBIIPYGVYOJSOV-UHFFFAOYSA-N
SMILES:BrC1=CC=NC=2NC=C(I)C12
- Synonyms:
- 4-bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-bromo-3-iodo-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrrolo[2,3-b]pyridine, 4-bromo-3-iodo- REF: IN-DA0000E0CAS: 1000340-34-0 | 95% | To inquire | Mon 10 Mar 25 |
![]() | 4-Bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine REF: 54-OR301273CAS: 1000340-34-0 | 95+% | 91.00 €~443.00 € | Mon 17 Mar 25 |
![]() | 4-Bromo-3-iodo-7-azaindole REF: 10-F077120CAS: 1000340-34-0 | 95.0% | To inquire | Tue 18 Mar 25 |
![]() | 4-Bromo-3-iodo-7-azaindole REF: 3D-FB144028CAS: 1000340-34-0 | Min. 95% | - - - | Discontinued product |

1H-Pyrrolo[2,3-b]pyridine, 4-bromo-3-iodo-
Ref: IN-DA0000E0
1g | 87.00 € | ||
100mg | 31.00 € | ||
250mg | 46.00 € | ||
500mg | 61.00 € |

Ref: 54-OR301273
1g | 161.00 € | ||
5g | 443.00 € | ||
250mg | 91.00 € |

4-Bromo-3-iodo-7-azaindole
Ref: 10-F077120
1g | To inquire | ||
250mg | To inquire |

4-Bromo-3-iodo-7-azaindole
Ref: 3D-FB144028
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |