CAS 1000340-40-8

3-Iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine

Description:

3-Iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of an iodine atom at the 3-position and a nitro group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for various chemical reactions, including electrophilic substitutions due to the electron-withdrawing nature of the nitro group and the halogen. The compound may also display interesting biological activities, making it a candidate for further research in drug development. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 3-Iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine is a valuable compound in the field of organic synthesis and pharmaceutical research.

Formula: C₇H₄IN₃O₂

InChI: InChI=1S/C7H4IN3O2/c8-4-3-10-7-6(4)5(11(12)13)1-2-9-7/h1-3H,(H,9,10)

InChI key: InChIKey=XLVXZIOZDIALSM-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=NC=C1)NC=C2I

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 3-iodo-4-nitro-
• 3-Iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine

1H-Pyrrolo[2,3-b]pyridine, 3-iodo-4-nitro-

CAS: 1000340-40-8

Formula: C₇H₄IN₃O₂

Purity: 97%

Molecular weight: 289.0300

Ref: IN-DA0000DU

3-iodo-4-nitro-1H-pyrrolo[2,3-b]pyridine

CAS: 1000340-40-8

Formula: C₇H₄IN₃O₂

Purity: 97%

Molecular weight: 289.032

Ref: 10-F517121