CymitQuimica logo

CAS 1000340-44-2

:

4-Nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:
4-Nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a nitro group and a carboxylic acid functional group. This compound typically exhibits a pale yellow to brownish appearance and is soluble in polar solvents, reflecting its polar functional groups. The presence of the nitro group contributes to its potential as a reactive intermediate in various chemical reactions, while the carboxylic acid group can participate in acid-base chemistry and hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 4-Nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a versatile compound with significant implications in chemical research and development.
Formula:C8H5N3O4
InChI:InChI=1S/C8H5N3O4/c12-8(13)4-3-10-7-6(4)5(11(14)15)1-2-9-7/h1-3H,(H,9,10)(H,12,13)
InChI key:InChIKey=GLWOBXJVRRKBED-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=NC=CC2N(=O)=O
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-nitro-
  • 4-Nitro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.