CAS 1000340-46-4
:4-Cyano-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
Description:
4-Cyano-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH), making it a versatile building block in organic synthesis and medicinal chemistry. The presence of the cyano group enhances its reactivity, allowing for various chemical transformations, while the carboxylic acid group can participate in hydrogen bonding and serve as a site for further functionalization. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of bioactive molecules. Additionally, the compound's unique arrangement of nitrogen atoms within the rings may influence its electronic properties, making it of interest in materials science and coordination chemistry. Overall, 4-Cyano-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a significant compound with diverse applications in various fields of chemistry.
Formula:C9H5N3O2
InChI:InChI=1S/C9H5N3O2/c10-3-5-1-2-11-8-7(5)6(4-12-8)9(13)14/h1-2,4H,(H,11,12)(H,13,14)
InChI key:InChIKey=RMWDOEYDAZDORR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=NC=CC2C#N
Synonyms:- 4-Cyano-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
- 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-cyano-
- 4-Cyano-7H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
- 4-CYANO-7-AZAINDOLE-3-CARBOXYLIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
