CAS 1000340-49-7
:5-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one
Description:
5-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an amino group (-NH2) and a fluorine atom (-F) at specific positions on the indazole structure contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its fluorine substituent can influence the compound's reactivity and biological activity, often enhancing lipophilicity and metabolic stability. 5-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of pharmaceuticals targeting various biological pathways. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of study in materials science and organic synthesis.
Formula:C7H6FN3O
InChI:InChI=1S/C7H6FN3O/c8-6-3(9)1-2-4-5(6)7(12)11-10-4/h1-2H,9H2,(H2,10,11,12)
InChI key:InChIKey=FOLJEZKPWCELDD-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1N)NNC2=O
Synonyms:- 5-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one
- 3H-Indazol-3-one, 5-amino-4-fluoro-1,2-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
