CymitQuimica logo

CAS 1000340-50-0

:

3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile

Description:
3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of an amino group and a cyano group enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino group, while its aromatic nature may impart some degree of stability. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the structural features may influence biological activity. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Additionally, its CAS number, 1000340-50-0, serves as a unique identifier for regulatory and safety information. Overall, 3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is of interest in both synthetic and medicinal chemistry due to its distinctive structure and functional groups.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-3-5-1-2-11-8-7(5)6(10)4-12-8/h1-2,4H,10H2,(H,11,12)
InChI key:InChIKey=KTJZUCSOJCVMGI-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(NC=C2N)=NC=C1
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 3-amino-
  • 3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.