
CAS 1000340-52-2: 3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
Description:3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and a pyrrole ring fused together. The presence of a nitro group at the 3-position and a cyano group at the 4-position contributes to its unique chemical reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. The nitro group can serve as a site for further chemical modifications, while the carbonitrile group may enhance the compound's ability to interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic system. Overall, 3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is of interest for its potential applications in drug discovery and development.
Formula:C8H4N4O2
InChI:InChI=1S/C8H4N4O2/c9-3-5-1-2-10-8-7(5)6(4-11-8)12(13)14/h1-2,4H,(H,10,11)
InChI key:InChIKey=AWYHBXNFPVDIEC-UHFFFAOYSA-N
SMILES:N#CC1=CC=NC=2NC=C(C12)N(=O)=O
- Synonyms:
- 1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 3-nitro-
- 3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 3-nitro- REF: IN-DA0000EWCAS: 1000340-52-2 | - - - | To inquire | Fri 07 Mar 25 |
![]() | 4-Cyano-3-nitro-7-azaindole REF: 3D-AQB34052CAS: 1000340-52-2 | Min. 95% | - - - | Discontinued product |

1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 3-nitro-
Ref: IN-DA0000EW
Undefined size | To inquire |

4-Cyano-3-nitro-7-azaindole
Ref: 3D-AQB34052
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |