
CAS 1000340-56-6
:4-Bromo-3-iodo-6-methyl-1H-pyrrolo[2,3-b]pyridine
Description:
4-Bromo-3-iodo-6-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyridine and pyrrole rings. This compound features bromine and iodine substituents, which can significantly influence its reactivity and physical properties. The presence of the methyl group enhances its lipophilicity, potentially affecting its solubility in organic solvents. The compound is likely to exhibit interesting biological activity due to its structural features, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the halogen substituents may facilitate further chemical modifications, allowing for the synthesis of derivatives with varied properties. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, 4-Bromo-3-iodo-6-methyl-1H-pyrrolo[2,3-b]pyridine represents a valuable compound for further exploration in both synthetic and applied chemistry.
Formula:C8H6BrIN2
InChI:InChI=1S/C8H6BrIN2/c1-4-2-5(9)7-6(10)3-11-8(7)12-4/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=ZJARWKLBXPTOCN-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NC(C)=C1)NC=C2I
Synonyms:- 4-Bromo-3-iodo-6-methyl-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-bromo-3-iodo-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
