CAS 1000340-59-9
:6,7-Dimethyl-1H-indazole-3-carboxaldehyde
Description:
6,7-Dimethyl-1H-indazole-3-carboxaldehyde is an organic compound characterized by its indazole structure, which consists of a five-membered ring fused to a six-membered aromatic ring. This compound features two methyl groups at the 6 and 7 positions of the indazole ring, contributing to its unique chemical properties and potential reactivity. The presence of a carboxaldehyde functional group at the 3-position enhances its reactivity, making it suitable for various synthetic applications, including the formation of more complex molecules through condensation reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. Additionally, its unique characteristics may lend themselves to applications in materials science and organic synthesis. As with many chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-6-3-4-8-9(5-13)11-12-10(8)7(6)2/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=LPEXVEWAEXGBLF-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=C(C)C(C)=CC2)NN1
Synonyms:- 1H-Indazole-3-carboxaldehyde, 6,7-dimethyl-
- 6,7-Dimethyl-1H-indazole-3-carboxaldehyde
- 6,7-DIMETHYL-3-FORMYL (1H)INDAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
