CAS 1000340-62-4
:6-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
Description:
6-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methyl group at the 6-position and a cyano group at the 4-position enhances its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. Its structure allows for various functionalization possibilities, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, which is of interest in drug discovery. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and exhibit basicity due to the nitrogen atoms in its rings. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, 6-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H7N3
InChI:InChI=1S/C9H7N3/c1-6-4-7(5-10)8-2-3-11-9(8)12-6/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=LJSPMLBMBSJULN-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=NC(C)=C1)NC=C2
Synonyms:- 6-Methyl-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
- 1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
