CAS 1000340-65-7
:4-Fluoro-7-methyl-1H-indazole-3-carboxylic acid
Description:
4-Fluoro-7-methyl-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluoro group at the 4-position and a methyl group at the 7-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 3-position, which imparts acidic characteristics and enhances its solubility in polar solvents. The molecular structure allows for potential interactions with biological targets, making it of interest in pharmaceutical research. Its CAS number, 1000340-65-7, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. The compound's reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which may affect its acidity and overall stability. Additionally, its potential applications in medicinal chemistry highlight the importance of understanding its characteristics for drug development and synthesis.
Formula:C9H7FN2O2
InChI:InChI=1S/C9H7FN2O2/c1-4-2-3-5(10)6-7(4)11-12-8(6)9(13)14/h2-3H,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=WXSDTPHSEMQJDO-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NN1)=C(C)C=CC2F
Synonyms:- 4-Fluoro-7-methyl-1H-indazole-3-carboxylic acid
- 1H-Indazole-3-carboxylic acid, 4-fluoro-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
