CAS 1000340-70-4
:6-Bromo-4-nitro-1H-pyrrolo[2,3-b]pyridine
Description:
6-Bromo-4-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a bromine atom and a nitro group at specific positions on the pyrrolo structure enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, making it suitable for various synthetic reactions. Its molecular structure allows for potential interactions with biological targets, which is of interest in drug development. Additionally, the presence of the nitro group can influence the compound's electronic properties, potentially affecting its behavior in chemical reactions and interactions with other molecules. Overall, 6-Bromo-4-nitro-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in research and industry, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-6-3-5(11(12)13)4-1-2-9-7(4)10-6/h1-3H,(H,9,10)
InChI key:InChIKey=UFGYCSWXPJGXDT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=NC(Br)=C1)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 6-bromo-4-nitro-
- 6-Bromo-4-nitro-1H-pyrrolo[2,3-b]pyridine
- 4-NITRO-6-BROMO-7-AZAINDOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
