CAS 1000340-75-9
:4,7-Dimethyl-1H-indazole-3-carboxaldehyde
Description:
4,7-Dimethyl-1H-indazole-3-carboxaldehyde is an organic compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 4 and 7 positions and an aldehyde functional group at the 3 position, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, which can be exploited in various chemical reactions. Additionally, the compound may have biological activity, making it of interest in medicinal chemistry. Its CAS number, 1000340-75-9, allows for easy identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, 4,7-Dimethyl-1H-indazole-3-carboxaldehyde is a versatile compound with potential applications in research and industry.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-6-3-4-7(2)10-9(6)8(5-13)11-12-10/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=AXNSIRJXHHTZIQ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=C(C)C=CC2C)NN1
Synonyms:- 1H-Indazole-3-carboxaldehyde, 4,7-dimethyl-
- 4,7-Dimethyl-1H-indazole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
