CAS 1000340-85-1
:3-Bromo-6-chloro-4-fluoro-1H-indazole
Description:
3-Bromo-6-chloro-4-fluoro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of bromine, chlorine, and fluorine substituents at specific positions (3, 6, and 4, respectively) contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its halogen substituents can influence its electronic properties, making it of interest in medicinal chemistry and material science. The compound may also exhibit biological activity, which can be explored for potential pharmaceutical applications. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C7H3BrClFN2
InChI:InChI=1S/C7H3BrClFN2/c8-7-6-4(10)1-3(9)2-5(6)11-12-7/h1-2H,(H,11,12)
InChI key:InChIKey=SNUBLQWKSXFCFT-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(Cl)=C1)NN=C2Br
Synonyms:- 1H-Indazole, 3-bromo-6-chloro-4-fluoro-
- 3-Bromo-6-chloro-4-fluoro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
