CAS 1000340-87-3
:6-(1-Methylethyl)-4-nitro-1H-indazole
Description:
6-(1-Methylethyl)-4-nitro-1H-indazole, identified by its CAS number 1000340-87-3, is a chemical compound that belongs to the indazole class of heterocyclic compounds. Characteristically, it features a nitro group (-NO2) at the 4-position and an isopropyl group (1-methylethyl) at the 6-position of the indazole ring system. This compound is typically characterized by its aromatic properties, which contribute to its stability and reactivity. The presence of the nitro group can influence its electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the isopropyl group may affect the compound's solubility and steric hindrance, impacting its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their unique structural features and reactivity profiles.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-6(2)7-3-9-8(5-11-12-9)10(4-7)13(14)15/h3-6H,1-2H3,(H,11,12)
InChI key:InChIKey=ZBXNMYBLEZPGEE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(C(C)C)=C1)NN=C2
Synonyms:- 6-(1-Methylethyl)-4-nitro-1H-indazole
- 1H-Indazole, 6-(1-methylethyl)-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
