
CAS 1000340-88-4
:6-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
Description:
6-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxyl group (-OH) at the 5-position and a methyl group (-CH3) at the 6-position of the pyrrole ring, influencing its reactivity and solubility. The presence of the hydroxyl group makes it a potential candidate for hydrogen bonding, enhancing its solubility in polar solvents. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various properties such as antioxidant activity or interactions with biological targets, although specific biological data would require further investigation. Additionally, its synthesis and characterization can involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 6-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-7(11)4-6-2-3-9-8(6)10-5/h2-4,11H,1H3,(H,9,10)
InChI key:InChIKey=NOPDTQDTGCBXNM-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=NC1C)NC=C2
Synonyms:- 6-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
- 1H-Pyrrolo[2,3-b]pyridin-5-ol, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
