CymitQuimica logo

CAS 1000340-90-8

:

5-Methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridine

Description:
5-Methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methoxy group at the 5-position and a methyl group at the 6-position enhances its solubility and reactivity. This compound is of interest in medicinal chemistry due to its potential biological activities, including neuroprotective and anti-inflammatory effects. Its structure allows for various interactions with biological targets, making it a candidate for drug development. The compound is typically synthesized through multi-step organic reactions, and its purity and identity can be confirmed using techniques such as NMR spectroscopy and mass spectrometry. As with many heterocycles, it may exhibit interesting electronic properties, influencing its behavior in chemical reactions and interactions with other molecules. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in research or industrial applications.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-8(12-2)5-7-3-4-10-9(7)11-6/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=FCDDMCDPVPGFAI-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=NC1C)NC=C2
Synonyms:
  • 5-Methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 5-methoxy-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.