CAS 1000340-91-9
:3-Iodo-6-(1-methylethyl)-4-nitro-1H-indazole
Description:
3-Iodo-6-(1-methylethyl)-4-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position and a nitro group at the 4-position contributes to its reactivity and potential applications in various chemical reactions. The substituent at the 6-position, specifically a 1-methylethyl group, enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential for interactions with biological targets, and the nitro group may serve as a site for reduction reactions. As with many halogenated compounds, it is essential to consider safety and environmental implications during handling and disposal. Overall, 3-Iodo-6-(1-methylethyl)-4-nitro-1H-indazole represents a unique structure with potential utility in research and development.
Formula:C10H10IN3O2
InChI:InChI=1S/C10H10IN3O2/c1-5(2)6-3-7-9(10(11)13-12-7)8(4-6)14(15)16/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=CIRRGFDFBGARJC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(C(C)C)=C1)NN=C2I
Synonyms:- 3-Iodo-6-(1-methylethyl)-4-nitro-1H-indazole
- 1H-Indazole, 3-iodo-6-(1-methylethyl)-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
