CAS 1000340-94-2
:6-Bromo-4-fluoro-1H-indazole-3-carbonitrile
Description:
6-Bromo-4-fluoro-1H-indazole-3-carbonitrile is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a fluorine atom at the 4-position contributes to its unique reactivity and potential applications in medicinal chemistry. The carbonitrile functional group at the 3-position enhances its polarity and can influence its biological activity. This compound is typically used in research settings, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. Its molecular structure allows for potential applications in areas such as cancer research and other therapeutic areas. The compound's properties, including solubility, stability, and reactivity, can vary based on the specific conditions under which it is handled. As with many halogenated compounds, it is important to consider safety and environmental factors when working with 6-Bromo-4-fluoro-1H-indazole-3-carbonitrile.
Formula:C8H3BrFN3
InChI:InChI=1S/C8H3BrFN3/c9-4-1-5(10)8-6(2-4)12-13-7(8)3-11/h1-2H,(H,12,13)
InChI key:InChIKey=ORJNWCYRTPZUCK-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NN1)=CC(Br)=CC2F
Synonyms:- 1H-Indazole-3-carbonitrile, 6-bromo-4-fluoro-
- 6-Bromo-4-fluoro-1H-indazole-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
