CAS 1000340-95-3
:3-Chloro-4-fluoro-5-nitro-1H-indazole
Description:
3-Chloro-4-fluoro-5-nitro-1H-indazole is a heterocyclic organic compound characterized by its indazole structure, which consists of a fused benzene and pyrazole ring. The presence of chlorine, fluorine, and nitro functional groups significantly influences its chemical properties and reactivity. The chlorine atom is typically electron-withdrawing, while the fluorine atom can enhance the compound's lipophilicity and stability. The nitro group is a strong electron-withdrawing group, which can affect the compound's acidity and reactivity in electrophilic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique combination of halogen and nitro substituents can also lead to interesting interactions in various chemical environments, potentially influencing its solubility and partitioning behavior. As with many indazole derivatives, it may serve as a scaffold for the development of pharmaceuticals or agrochemicals, warranting further investigation into its properties and applications.
Formula:C7H3ClFN3O2
InChI:InChI=1S/C7H3ClFN3O2/c8-7-5-3(10-11-7)1-2-4(6(5)9)12(13)14/h1-2H,(H,10,11)
InChI key:InChIKey=ISHYOBPRDANSPV-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1N(=O)=O)NN=C2Cl
Synonyms:- 1H-Indazole, 3-chloro-4-fluoro-5-nitro-
- 3-Chloro-4-fluoro-5-nitro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
