CymitQuimica logo

CAS 1000340-96-4

:

5-(Acetyloxy)-2-pyridinecarbonitrile

Description:
5-(Acetyloxy)-2-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the acetyloxy group indicates that it has an acetyl functional group (-COCH3) attached to an oxygen atom, which is further connected to the pyridine ring. The carbonitrile group (-C≡N) contributes to its reactivity and polarity, making it a versatile compound in organic synthesis. This compound is typically used in pharmaceutical and agrochemical research due to its potential biological activity. Its structure suggests that it may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. The presence of both the acetyloxy and carbonitrile functionalities may also influence its reactivity, allowing for various chemical transformations. Overall, 5-(Acetyloxy)-2-pyridinecarbonitrile is a valuable compound in synthetic chemistry, with applications that may extend to medicinal chemistry and material science.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c1-6(11)12-8-3-2-7(4-9)10-5-8/h2-3,5H,1H3
InChI key:InChIKey=NVSWNVIAPRLSCE-UHFFFAOYSA-N
SMILES:O(C(C)=O)C=1C=CC(C#N)=NC1
Synonyms:
  • 5-(Acetyloxy)-2-pyridinecarbonitrile
  • 2-Pyridinecarbonitrile, 5-(acetyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.