CymitQuimica logo

CAS 1000340-99-7

:

4-Bromo-2,6-dinitrobenzeneacetaldehyde

Description:
4-Bromo-2,6-dinitrobenzeneacetaldehyde is an organic compound characterized by its complex structure, which includes a bromine atom and two nitro groups attached to a benzene ring, along with an aldehyde functional group. This compound typically appears as a yellow to orange crystalline solid and is known for its reactivity due to the presence of both the nitro groups and the aldehyde. The nitro groups are electron-withdrawing, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the aldehyde group can participate in various chemical reactions, including condensation and oxidation. This compound may be used in synthetic organic chemistry, particularly in the development of dyes, pharmaceuticals, or as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this substance, as it may pose health risks due to its potential toxicity and reactivity. Proper storage and disposal methods are essential to mitigate any environmental impact.
Formula:C8H5BrN2O5
InChI:InChI=1S/C8H5BrN2O5/c9-5-3-7(10(13)14)6(1-2-12)8(4-5)11(15)16/h2-4H,1H2
InChI key:InChIKey=DAKCHEYGKGCSKM-UHFFFAOYSA-N
SMILES:C(C=O)C1=C(N(=O)=O)C=C(Br)C=C1N(=O)=O
Synonyms:
  • Benzeneacetaldehyde, 4-bromo-2,6-dinitro-
  • 4-Bromo-2,6-dinitrobenzeneacetaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.