CAS 1000341-03-6
:3-Iodo-6-(1-methylethyl)-1H-indazol-4-amine
Description:
3-Iodo-6-(1-methylethyl)-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position and an isopropyl group at the 6-position contributes to its unique reactivity and potential biological activity. The amine functional group at the 4-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the indazole structure can lead to various pharmacological properties. Its molecular structure suggests it may exhibit properties such as anti-inflammatory or anticancer activities, although specific biological effects would require empirical investigation. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the iodine atom and the isopropyl group, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C10H12IN3
InChI:InChI=1S/C10H12IN3/c1-5(2)6-3-7(12)9-8(4-6)13-14-10(9)11/h3-5H,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=JHPGOIKADMWJLK-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(C(C)C)=C1)NN=C2I
Synonyms:- 3-Iodo-6-(1-methylethyl)-1H-indazol-4-amine
- 1H-Indazol-4-amine, 3-iodo-6-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
