CAS 1000341-05-8
:3,5,7-Tribromo-4-methyl-1H-indazole
Description:
3,5,7-Tribromo-4-methyl-1H-indazole is a halogenated indazole derivative characterized by the presence of three bromine atoms and a methyl group attached to its indazole ring structure. This compound typically exhibits a high degree of lipophilicity due to the bromine substituents, which can influence its solubility and reactivity. The presence of bromine atoms often imparts unique electronic properties, potentially enhancing its reactivity in various chemical reactions, including electrophilic substitutions. Additionally, the indazole moiety contributes to its aromatic stability and may exhibit biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a synthetic intermediate. Its physical properties, such as melting point, boiling point, and spectral characteristics, would be influenced by the bromine substituents and the overall molecular framework. Safety and handling considerations are essential due to the presence of bromine, which can be hazardous.
Formula:C8H5Br3N2
InChI:InChI=1S/C8H5Br3N2/c1-3-4(9)2-5(10)7-6(3)8(11)13-12-7/h2H,1H3,(H,12,13)
InChI key:InChIKey=NKQGINAJCVXATC-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(Br)C=C1Br)NN=C2Br
Synonyms:- 3,5,7-Tribromo-4-methyl-1H-indazole
- 1H-Indazole, 3,5,7-tribromo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
