CAS 1000341-08-1

6-Methoxy-4-nitro-1H-indazole

Description:

6-Methoxy-4-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring structure containing two nitrogen atoms. The presence of a methoxy group (-OCH3) at the 6-position and a nitro group (-NO2) at the 4-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the methoxy group can serve as a potential site for further functionalization. 6-Methoxy-4-nitro-1H-indazole may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. As with many nitro-containing compounds, it is essential to handle this substance with care, considering potential toxicity and environmental impact.

Formula: C₈H₇N₃O₃

InChI: InChI=1S/C8H7N3O3/c1-14-5-2-7-6(4-9-10-7)8(3-5)11(12)13/h2-4H,1H3,(H,9,10)

InChI key: InChIKey=ACUQZJBBTADFHU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=CC(OC)=C1)NN=C2

Synonyms:

• 1H-Indazole, 6-methoxy-4-nitro-
• 6-Methoxy-4-nitro-1H-indazole

6-Methoxy-4-nitro-1H-indazole

CAS: 1000341-08-1

Formula: C₈H₇N₃O₃

Molecular weight: 193.1595

Ref: IN-DA0000G5