CAS 1000341-10-5
:6-Nitro-1H-indazole-3-methanol
Description:
6-Nitro-1H-indazole-3-methanol is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a nitro group at the 6-position and a hydroxymethyl group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxymethyl group, while its aromatic nature can influence its reactivity and interactions with other molecules. The nitro group can participate in electrophilic substitution reactions, making it a potential candidate for further chemical modifications. Additionally, compounds like 6-Nitro-1H-indazole-3-methanol may have biological activity, which can be explored in pharmaceutical research. Its specific applications and behavior in various chemical environments would depend on the context of its use, including potential roles in medicinal chemistry or as a synthetic intermediate. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.
Formula:C8H7N3O3
InChI:InChI=1S/C8H7N3O3/c12-4-8-6-2-1-5(11(13)14)3-7(6)9-10-8/h1-3,12H,4H2,(H,9,10)
InChI key:InChIKey=IBUYUAQQNOCNJJ-UHFFFAOYSA-N
SMILES:C(O)C=1C=2C(=CC(N(=O)=O)=CC2)NN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
