CAS 1000341-12-7
:3-Iodo-6-methoxy-4-nitro-1H-indazole
Description:
3-Iodo-6-methoxy-4-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position, a methoxy group (-OCH3) at the 6-position, and a nitro group (-NO2) at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit significant biological activity due to the presence of the nitro group, which can participate in various chemical reactions, and the iodine atom, which can enhance lipophilicity and influence the compound's interaction with biological targets. The methoxy group may also affect the compound's solubility and reactivity. Overall, 3-Iodo-6-methoxy-4-nitro-1H-indazole is of interest in medicinal chemistry and may serve as a lead compound for further pharmacological studies. Its specific applications and reactivity would depend on the context of its use in research or industry.
Formula:C8H6IN3O3
InChI:InChI=1S/C8H6IN3O3/c1-15-4-2-5-7(8(9)11-10-5)6(3-4)12(13)14/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=MVRUMBZYNRQEIK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(OC)=C1)NN=C2I
Synonyms:- 3-Iodo-6-methoxy-4-nitro-1H-indazole
- 1H-Indazole, 3-iodo-6-methoxy-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
