
CAS 1000341-13-8: 3-Bromo-6-methoxy-4-nitro-1H-indazole
Description:3-Bromo-6-methoxy-4-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 3-position, a methoxy group at the 6-position, and a nitro group at the 4-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with indazole derivatives. The nitro group can serve as a site for further chemical modifications, while the methoxy group may influence the compound's electronic properties and steric hindrance. As with many halogenated compounds, 3-Bromo-6-methoxy-4-nitro-1H-indazole may also exhibit interesting interactions in biological systems, making it a subject of interest for research in various fields, including organic synthesis and drug discovery.
Formula:C8H6BrN3O3
InChI:InChI=1S/C8H6BrN3O3/c1-15-4-2-5-7(8(9)11-10-5)6(3-4)12(13)14/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=JZUQOALONVLPBI-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=C(OC)C=C2NN=C(Br)C21
- Synonyms:
- 1H-Indazole, 3-bromo-6-methoxy-4-nitro-
- 3-Bromo-6-methoxy-4-nitro-1H-indazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Indazole, 3-bromo-6-methoxy-4-nitro- REF: IN-DA0000G0CAS: 1000341-13-8 | - - - | To inquire | Tue 11 Mar 25 |
![]() | 3-Bromo-6-methoxy-4-nitro-1H-indazole REF: 3D-AQB34113CAS: 1000341-13-8 | Min. 95% | - - - | Discontinued product |

3-Bromo-6-methoxy-4-nitro-1H-indazole
Ref: 3D-AQB34113
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |