CymitQuimica logo

CAS 1000341-15-0

:

3-Chloro-6-methoxy-4-nitro-1H-indazole

Description:
3-Chloro-6-methoxy-4-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 3-position, a methoxy group (-OCH3) at the 6-position, and a nitro group (-NO2) at the 4-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic substitution reactions. Additionally, the methoxy group can serve as a directing group in such reactions. The chlorine substituent can also affect the compound's overall polarity and potential biological activity. Overall, 3-Chloro-6-methoxy-4-nitro-1H-indazole is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and synthesis.
Formula:C8H6ClN3O3
InChI:InChI=1S/C8H6ClN3O3/c1-15-4-2-5-7(8(9)11-10-5)6(3-4)12(13)14/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=XWZNSOKZWXMKTD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(OC)=C1)NN=C2Cl
Synonyms:
  • 1H-Indazole, 3-chloro-6-methoxy-4-nitro-
  • 3-Chloro-6-methoxy-4-nitro-1H-indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.