CAS 1000341-19-4
:6-Bromo-3-iodo-4-methoxy-1H-pyrrolo[3,2-c]pyridine
Description:
6-Bromo-3-iodo-4-methoxy-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features a bromine atom at the 6-position and an iodine atom at the 3-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a methoxy group at the 4-position enhances its solubility and may influence its biological activity. As a halogenated compound, it may exhibit unique electronic properties and participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. The compound's structure suggests potential use in the development of pharmaceuticals, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including halogenation and methoxylation reactions. Overall, 6-Bromo-3-iodo-4-methoxy-1H-pyrrolo[3,2-c]pyridine represents a valuable compound for research in organic synthesis and drug discovery.
Formula:C8H6BrIN2O
InChI:InChI=1S/C8H6BrIN2O/c1-13-8-7-4(10)3-11-5(7)2-6(9)12-8/h2-3,11H,1H3
InChI key:InChIKey=PSJGFSMNRKCAMH-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NC=C2I)=CC(Br)=N1
Synonyms:- 1H-Pyrrolo[3,2-c]pyridine, 6-bromo-3-iodo-4-methoxy-
- 6-Bromo-3-iodo-4-methoxy-1H-pyrrolo[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
