CAS 1000341-20-7
:6-Methoxy-1H-indazol-4-amine
Description:
6-Methoxy-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a methoxy group (-OCH3) at the 6-position and an amino group (-NH2) at the 4-position contributes to its unique chemical properties. This compound is often studied for its potential biological activities, including its role in medicinal chemistry and drug development. It may exhibit various pharmacological effects, making it of interest in the fields of biochemistry and pharmacology. The compound's molecular structure allows for interactions with biological targets, which can lead to therapeutic applications. Additionally, its solubility and stability can vary based on environmental conditions, influencing its behavior in biological systems. As with many chemical substances, safety and handling precautions are essential when working with 6-Methoxy-1H-indazol-4-amine, particularly in laboratory settings.
Formula:C8H9N3O
InChI:InChI=1S/C8H9N3O/c1-12-5-2-7(9)6-4-10-11-8(6)3-5/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=GFDOZLUNMUNFEY-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(OC)=C1)NN=C2
Synonyms:- 1H-Indazol-4-amine, 6-methoxy-
- 6-Methoxy-1H-indazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
