CAS 1000341-26-3
:6-Methoxy-4-nitro-1H-indazole-3-carboxaldehyde
Description:
6-Methoxy-4-nitro-1H-indazole-3-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a methoxy group (-OCH3) at the 6-position and a nitro group (-NO2) at the 4-position contributes to its unique reactivity and properties. The carboxaldehyde functional group (-CHO) at the 3-position enhances its potential for further chemical transformations, making it a valuable intermediate in organic synthesis. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential biological activity. Its molecular structure suggests that it may exhibit properties such as fluorescence or specific interactions with biological targets, although detailed studies would be necessary to elucidate its full range of characteristics and applications. As with many organic compounds, safety and handling precautions should be observed, given the presence of reactive functional groups.
Formula:C9H7N3O4
InChI:InChI=1S/C9H7N3O4/c1-16-5-2-6-9(7(4-13)11-10-6)8(3-5)12(14)15/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=HFVPVBUGMTYFIU-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(OC)=C1)NN=C2C=O
Synonyms:- 1H-Indazole-3-carboxaldehyde, 6-methoxy-4-nitro-
- 6-Methoxy-4-nitro-1H-indazole-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
