CymitQuimica logo

CAS 1000341-31-0

:

4-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde

Description:
4-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity and biological activity. The aldehyde functional group (-CHO) is notable for its reactivity, particularly in condensation reactions and as a potential electrophile in various organic transformations. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure can influence its interactions with biological targets, potentially leading to specific therapeutic effects. As with many heterocycles, the stability and reactivity of 4-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde can be affected by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-13-9-8-6(5-12)4-11-7(8)2-3-10-9/h2-5,11H,1H3
InChI key:InChIKey=FYWALQVURBDJKB-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=CC=NC2OC
Synonyms:
  • 4-Methoxy-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde
  • 1H-Pyrrolo[3,2-c]pyridine-3-carboxaldehyde, 4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.