CAS 1000341-39-8
:3-Chloro-1H-indazole-4-carbonitrile
Description:
3-Chloro-1H-indazole-4-carbonitrile is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 3-position and a cyano group (-C≡N) at the 4-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often utilized in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The cyano group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the chlorine substituent can influence the compound's electronic properties and reactivity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Chloro-1H-indazole-4-carbonitrile is an important compound in the field of organic chemistry and drug development.
Formula:C8H4ClN3
InChI:InChI=1S/C8H4ClN3/c9-8-7-5(4-10)2-1-3-6(7)11-12-8/h1-3H,(H,11,12)
InChI key:InChIKey=RPLUAXWKHICSNL-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(NN=C2Cl)=CC=C1
Synonyms:- 3-Chloro-1H-indazole-4-carbonitrile
- 1H-Indazole-4-carbonitrile, 3-chloro-
- 3-Chloro-2H-indazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
