CymitQuimica logo

CAS 1000341-43-4

:

3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid

Description:
3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of a bromine atom at the 3-position and a carboxylic acid functional group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, which is of interest for drug development. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns. Overall, 3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid is a significant compound in the field of organic chemistry and drug discovery.
Formula:C8H5BrN2O2
InChI:InChI=1S/C8H5BrN2O2/c9-4-3-11-5-1-2-10-7(6(4)5)8(12)13/h1-3,11H,(H,12,13)
InChI key:InChIKey=BSDGCRRFFXKHMG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC=N1)NC=C2Br
Synonyms:
  • 3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid
  • 1H-Pyrrolo[3,2-c]pyridine-4-carboxylic acid, 3-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.