CymitQuimica logo

CAS 1000341-52-5

:

7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid

Description:
7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. This compound features a carboxylic acid functional group at the 3-position and a methyl group at the 7-position of the pyrrole ring. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carboxylic acid group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. Additionally, the compound's unique ring system may impart specific pharmacological properties, which can be explored in various therapeutic contexts. As with many heterocycles, it may exhibit interesting electronic properties due to the delocalization of electrons within the aromatic system. Overall, 7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid represents a valuable scaffold for further research in chemical and pharmaceutical applications.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-5-2-10-3-6-7(9(12)13)4-11-8(5)6/h2-4,11H,1H3,(H,12,13)
InChI key:InChIKey=UOORYHKUOBPHCI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=C(C)C=NC2
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid, 7-methyl-
  • 7-Methyl-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.