CymitQuimica logo

CAS 1000341-56-9

:

N-1H-Pyrrolo[2,3-b]pyridin-6-ylacetamide

Description:
N-1H-Pyrrolo[2,3-b]pyridin-6-ylacetamide is a chemical compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. This compound features an acetamide functional group, contributing to its potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. The presence of nitrogen atoms in the rings can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may possess specific pharmacological properties, which could be explored for therapeutic applications. Its molecular structure suggests potential for hydrogen bonding and interactions with various biological macromolecules, which is crucial for drug design. Overall, N-1H-Pyrrolo[2,3-b]pyridin-6-ylacetamide represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-6(13)11-8-3-2-7-4-5-10-9(7)12-8/h2-5H,1H3,(H2,10,11,12,13)
InChI key:InChIKey=BUBDLXXMNJMZNL-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1N=C2C(=CC1)C=CN2
Synonyms:
  • Acetamide, N-1H-pyrrolo[2,3-b]pyridin-6-yl-
  • N-1H-Pyrrolo[2,3-b]pyridin-6-ylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.