CAS 1000341-57-0

Methyl 3,7-dichloro-1H-indazole-5-carboxylate

Description:

Methyl 3,7-dichloro-1H-indazole-5-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of dichloro substituents at the 3 and 7 positions contributes to its unique reactivity and potential biological activity. The carboxylate group at the 5 position, along with the methyl ester functionality, enhances its solubility in organic solvents and may influence its pharmacokinetic properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that may interact with biological targets. Its molecular structure suggests it may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm such effects. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₉H₆Cl₂N₂O₂

InChI: InChI=1S/C9H6Cl2N2O2/c1-15-9(14)4-2-5-7(6(10)3-4)12-13-8(5)11/h2-3H,1H3,(H,12,13)

InChI key: InChIKey=PSIGTFZGKWSTKX-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=C(Cl)C=C(C(OC)=O)C2)NN1

Synonyms:

• 1H-Indazole-5-carboxylic acid, 3,7-dichloro-, methyl ester
• Methyl 3,7-dichloro-1H-indazole-5-carboxylate