CAS 1000341-64-9: 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde
Description:6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. The presence of a chloro substituent at the 6-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for various chemical transformations, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's reactivity can be influenced by the electron-withdrawing nature of the chloro group and the aldehyde functionality, which can participate in nucleophilic addition reactions. Additionally, the presence of heteroatoms in the ring system can affect its electronic properties and biological activity, making it a subject of interest in drug discovery and development. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H5ClN2O
InChI:InChI=1S/C8H5ClN2O/c9-8-1-7-6(3-11-8)5(4-12)2-10-7/h1-4,10H
InChI key:InChIKey=MMBBXYKIDWFQOP-UHFFFAOYSA-N
SMILES:O=CC1=CNC=2C=C(Cl)N=CC12
- Synonyms:
- 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde
- 1H-Pyrrolo[3,2-c]pyridine-3-carboxaldehyde, 6-chloro-
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1H-Pyrrolo[3,2-c]pyridine-3-carboxaldehyde, 6-chloro-
Ref: IN-DA0000HE
1g | 157.00 € | ||
100mg | 42.00 € | ||
250mg | 57.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde
Ref: 10-F232869
1g | 176.00 € | ||
250mg | 93.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde
Ref: 54-OR918922
100mg | 51.00 € | ||
250mg | 98.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde
Ref: 3D-FC141352
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |