CAS 1000341-65-0
:7-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one
Description:
7-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which features a fluorine atom and an amino group. This compound typically exhibits a solid-state at room temperature and is soluble in polar solvents, which is common for many nitrogen-containing heterocycles. The presence of the amino group suggests potential for hydrogen bonding, influencing its reactivity and interactions with biological targets. The fluorine atom can enhance lipophilicity and metabolic stability, making this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure may allow for various functionalizations, enabling the exploration of its biological activity, including potential anti-inflammatory or anticancer properties. The compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a synthetic or biological environment. Overall, 7-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one represents a versatile scaffold for further chemical exploration and application in drug discovery.
Formula:C7H6FN3O
InChI:InChI=1S/C7H6FN3O/c8-3-1-2-4(9)6-5(3)7(12)11-10-6/h1-2H,9H2,(H2,10,11,12)
InChI key:InChIKey=AIBMAXWDVAMDAE-UHFFFAOYSA-N
SMILES:NC1=C2C(C(=O)NN2)=C(F)C=C1
Synonyms:- 3H-Indazol-3-one, 7-amino-4-fluoro-1,2-dihydro-
- 7-Amino-4-fluoro-1,2-dihydro-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
