CAS 1000341-66-1
:4-Fluoro-7-iodo-1H-indole
Description:
4-Fluoro-7-iodo-1H-indole is a heterocyclic organic compound characterized by the presence of both fluorine and iodine substituents on the indole ring system. The indole structure consists of a fused benzene and pyrrole ring, which contributes to its aromaticity and stability. The fluorine atom, being electronegative, can influence the compound's reactivity and polarity, while the iodine atom can enhance its lipophilicity and potential for biological activity. This compound is typically used in medicinal chemistry and research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique halogen substitutions may also affect its interaction with biological receptors or enzymes. Additionally, 4-Fluoro-7-iodo-1H-indole may exhibit interesting photophysical properties, making it a candidate for studies in materials science or fluorescence applications. As with many halogenated compounds, safety and handling precautions are essential due to the potential toxicity of halogenated organic substances.
Formula:C8H5FIN
InChI:InChI=1S/C8H5FIN/c9-6-1-2-7(10)8-5(6)3-4-11-8/h1-4,11H
InChI key:InChIKey=LKQJTXCNRGRZQD-UHFFFAOYSA-N
SMILES:FC1=C2C(=C(I)C=C1)NC=C2
Synonyms:- 1H-Indole, 4-fluoro-7-iodo-
- 4-Fluoro-7-iodo-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
