CAS 1000341-67-2: 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid
Description:6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 3-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate to high stability under standard conditions, although it may be sensitive to strong bases or acids due to the carboxylic acid group. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the electrophilic chlorine atom. Overall, 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid is a versatile compound with applications in research and potential therapeutic uses.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c9-7-1-6-4(2-11-7)5(3-10-6)8(12)13/h1-3,10H,(H,12,13)
InChI key:InChIKey=RMSBIZUSTXPPBW-UHFFFAOYSA-N
SMILES:O=C(O)C1=CNC=2C=C(Cl)N=CC21
- Synonyms:
- 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid
- 1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid, 6-chloro-

1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid, 6-chloro-
Ref: IN-DA0000HB
1g | 164.00 € | ||
5g | To inquire | ||
100mg | 65.00 € | ||
250mg | 73.00 € |

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid
Ref: 54-OR75562
1g | 269.00 € | ||
5g | 1,179.00 € | ||
250mg | 105.00 € |

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid
Ref: 10-F336017
1g | 146.00 € | ||
5g | 602.00 € | ||
100mg | 24.00 € | ||
250mg | 43.00 € |

6-chloro-1h-pyrrolo[3,2-c]pyridine-3-carboxylic acid
Ref: 3D-AQB34167
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |