CAS 1000341-67-2

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid

Description:

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 3-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate to high stability under standard conditions, although it may be sensitive to strong bases or acids due to the carboxylic acid group. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the electrophilic chlorine atom. Overall, 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid is a versatile compound with applications in research and potential therapeutic uses.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1S/C8H5ClN2O2/c9-7-1-6-4(2-11-7)5(3-10-6)8(12)13/h1-3,10H,(H,12,13)

InChI key: InChIKey=RMSBIZUSTXPPBW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=CC(Cl)=NC2

Synonyms:

• 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid
• 1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid, 6-chloro-

1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid, 6-chloro-

CAS: 1000341-67-2

Formula: C₈H₅ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.5905

Ref: IN-DA0000HB

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid

CAS: 1000341-67-2

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid

Purity: 97%

Molecular weight: 196.59g/mol

Ref: 54-OR75562

6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid

CAS: 1000341-67-2

Formula: C₈H₅ClN₂O₂

Purity: 97%

Molecular weight: 196.59

Ref: 10-F336017