CAS 1000341-68-3
:4,7-Difluoro-1H-indazole
Description:
4,7-Difluoro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of two fluorine atoms at the 4 and 7 positions of the indazole structure significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The fluorine substituents can enhance the compound's lipophilicity and metabolic stability, making it an interesting candidate for drug design. Additionally, 4,7-difluoro-1H-indazole may exhibit unique spectroscopic properties, which can be useful in analytical chemistry for identification and quantification. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C7H4F2N2
InChI:InChI=1S/C7H4F2N2/c8-5-1-2-6(9)7-4(5)3-10-11-7/h1-3H,(H,10,11)
InChI key:InChIKey=GEDRPWSWQBCAAN-UHFFFAOYSA-N
SMILES:FC1=C2C(=C(F)C=C1)NN=C2
Synonyms:- 1H-Indazole, 4,7-difluoro-
- 4,7-Difluoro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
