CAS 1000341-71-8
:3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carbonitrile
Description:
3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a bromine atom at the 3-position and a cyano group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in polar organic solvents, and its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery. The cyano group can participate in nucleophilic reactions, while the bromine atom can serve as a leaving group in various synthetic pathways. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Its CAS number, 1000341-71-8, allows for easy identification in chemical databases, facilitating research and development in fields such as pharmaceuticals and agrochemicals. Overall, 3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carbonitrile is a valuable compound for further exploration in synthetic and medicinal chemistry.
Formula:C8H4BrN3
InChI:InChI=1S/C8H4BrN3/c9-5-4-12-6-1-2-11-7(3-10)8(5)6/h1-2,4,12H
InChI key:InChIKey=UBNCCIDMDSHYSA-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(NC=C2Br)=CC=N1
Synonyms:- 3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carbonitrile
- 1H-Pyrrolo[3,2-c]pyridine-4-carbonitrile, 3-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
