CAS 1000341-80-9

4-Chloro-7-methoxy-1H-indole

Description:

4-Chloro-7-methoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 4-position and a methoxy group at the 7-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. It is often used in research and development, particularly in the fields of medicinal chemistry and pharmacology, due to its potential biological activities. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methoxy group may enhance its lipophilicity. As with many indole derivatives, 4-Chloro-7-methoxy-1H-indole may exhibit fluorescence, making it useful in various analytical applications. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, this compound represents a valuable structure for further exploration in chemical and biological research.

Formula: C₉H₈ClNO

InChI: InChI=1S/C9H8ClNO/c1-12-8-3-2-7(10)6-4-5-11-9(6)8/h2-5,11H,1H3

InChI key: InChIKey=HBGCLPKVGVRSKB-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=C(Cl)C=C1)C=CN2

Synonyms:

• 4-Chloro-7-methoxy-1H-indole
• 1H-Indole, 4-chloro-7-methoxy-

4-Chloro-7-methoxy-1H-indole

CAS: 1000341-80-9

Formula: C₉H₈ClNO

Molecular weight: 181.6189

Ref: IN-DA0000IC